logo
Home  > 1,1-Dimethylethyl N-methyl-N-[(3S)-3-pyrrolidinylmethyl]carbamate

AE31597

1064052-00-1 | 1,1-Dimethylethyl N-methyl-N-[(3S)-3-pyrrolidinylmethyl]carbamate

Packsize Purity Availability Price Discounted Price    Quantity
100mg 95% in stock $214.00 $150.00 -   +
250mg 95% in stock $341.00 $239.00 -   +
500mg 95% in stock $567.00 $397.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AE31597
Chemical Name: 1,1-Dimethylethyl N-methyl-N-[(3S)-3-pyrrolidinylmethyl]carbamate
CAS Number: 1064052-00-1
Molecular Formula: C11H22N2O2
Molecular Weight: 214.30458000000007
MDL Number: MFCD11616657
SMILES: O=C(N(C[C@@H]1CNCC1)C)OC(C)(C)C

 

Upstream Synthesis Route 
  • The 1,1-Dimethylethyl N-methyl-N-[(3S)-3-pyrrolidinylmethyl]carbamate plays a crucial role in chemical synthesis, particularly in the field of organic chemistry. This compound serves as a versatile building block for the creation of various complex molecules due to its unique structural features. In chemical synthesis, it can be used as a key intermediate in the production of pharmaceuticals, agrochemicals, and fine chemicals. Its specific combination of functional groups allows for efficient manipulation and modification to facilitate the synthesis of diverse chemical compounds with specific properties and functions. By incorporating 1,1-Dimethylethyl N-methyl-N-[(3S)-3-pyrrolidinylmethyl]carbamate into synthetic pathways, chemists can access a wide range of structural motifs and molecular scaffolds, making it an invaluable tool for designing and developing new molecules with potential applications in various industries.
FEATURED PRODUCTS