AE08117
Availability | ||
---|---|---|
Typically In Stock |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE08117 |
Chemical Name: | CYANOPINDOLOL HEMIFUMARATE |
CAS Number: | 106469-57-2 |
Molecular Formula: | C36H46N6O8 |
Molecular Weight: | 690.7858 |
MDL Number: | MFCD09878229 |
SMILES: | OC(=O)C=CC(=O)O.N#Cc1[nH]c2c(c1)c(OCC(CNC(C)(C)C)O)ccc2.N#Cc1[nH]c2c(c1)c(OCC(CNC(C)(C)C)O)ccc2 |
Cyanopindolol hemifumarate is a potent and selective β-adrenergic receptor antagonist that finds application in chemical synthesis as a valuable reagent. This compound is known for its ability to specifically block the activity of β-adrenergic receptors, making it a crucial tool in the study of adrenergic signaling pathways and related physiological processes. In organic chemistry, Cyanopindolol hemifumarate can be utilized to investigate receptor-ligand interactions, as well as in the development of new pharmaceuticals targeting the β-adrenergic system. Its unique properties make it a versatile compound for research purposes in the field of drug discovery and medicinal chemistry.