AE12459
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 99% | 2 weeks | $1,534.00 | $1,074.00 | - + | |
5mg | 99% | 2 weeks | $3,784.00 | $2,649.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE12459 |
Chemical Name: | 2,3-DIMETHOXY-5-METHYL-6-[ALL TRANS]FARNESYLFARNESYL-1,4-BENZOQUINONE |
CAS Number: | 1065-31-2 |
Molecular Formula: | C39H58O4 |
Molecular Weight: | 590.8754 |
MDL Number: | MFCD00055698 |
SMILES: | COC1=C(OC)C(=O)C(=C(C1=O)C/C=C(/CC/C=C(/CC/C=C(/CC/C=C(/CC/C=C(/CCC=C(C)C)C)C)C)C)C)C |
Coenzyme Q6, also known as ubiquinone-6, is a vital co-factor in various chemical synthesis processes. Its unique structure and properties make it an essential component in the production of pharmaceuticals, cosmetics, and organic compounds.In chemical synthesis, Coenzyme Q6 plays a crucial role as a powerful antioxidant, facilitating various redox reactions. Its ability to undergo reversible oxidation-reduction reactions makes it valuable in promoting electron transfer processes. This makes it an ideal catalyst in the synthesis of organic molecules where redox reactions are involved.Moreover, Coenzyme Q6 is utilized in the synthesis of vitamin K and other quinone-derived compounds. Its presence is often necessary to drive complex biosynthetic pathways, contributing to the production of essential compounds for human health and well-being.Overall, Coenzyme Q6's versatile applications in chemical synthesis make it a valuable tool in the creation of a wide range of compounds, highlighting its significance in the field of organic chemistry.