logo
Home  > Ganodermanontriol

AE17184

106518-63-2 | Ganodermanontriol

Packsize Purity Availability Price Discounted Price    Quantity
1mg 90% in stock $290.00 $203.00 -   +
5mg 90% in stock $1,230.00 $861.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AE17184
Chemical Name: Ganodermanontriol
CAS Number: 106518-63-2
Molecular Formula: C30H48O4
Molecular Weight: 472.6997
MDL Number: MFCD06799868
SMILES: OC[C@]([C@H](CC[C@H]([C@H]1CC[C@@]2([C@]1(C)CC=C1C2=CC[C@@H]2[C@]1(C)CCC(=O)C2(C)C)C)C)O)(O)C

 

Upstream Synthesis Route
  • Ganodermanontriol is a triterpenoid compound isolated from Ganoderma lucidum mushrooms, also known as Lingzhi in traditional Chinese medicine. In chemical synthesis, Ganodermanontriol is widely utilized for its unique structural properties and versatile reactivity. One of the key applications of Ganodermanontriol in chemical synthesis is its role as a precursor in the synthesis of various bioactive compounds. Due to its complex and functionalized structure, Ganodermanontriol can be modified through chemical reactions to produce derivatives with enhanced biological activities. For example, it can serve as a starting material for the synthesis of novel anti-inflammatory agents, antioxidant compounds, or potential anticancer drugs.Furthermore, Ganodermanontriol's ability to undergo selective functionalization reactions makes it a valuable building block in organic synthesis. By strategically modifying specific functional groups within its molecular structure, chemists can tailor the properties of Ganodermanontriol derivatives for specific applications in drug discovery, medicinal chemistry, or material science.Overall, Ganodermanontriol plays a crucial role in advancing the field of chemical synthesis by serving as a versatile starting material for the development of bioactive molecules and functionalized compounds with diverse applications in various industries.
FEATURED PRODUCTS