AX63202
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 95% | in stock | $200.00 | $140.00 | - + | |
5mg | 95% | in stock | $400.00 | $280.00 | - + | |
10mg | 95% | in stock | $600.00 | $420.00 | - + | |
25mg | 95% | in stock | $1,172.00 | $820.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AX63202 |
Chemical Name: | Glucagon-like peptide 1 (Rana catesbeiana), 3-L-glutamicacid-10-L-valine-16-glycine-17-L-glutamine-23-L-isoleucine-24-L-alanine-27-L-valine-31-glycine-32-de-L-lysine- |
CAS Number: | 106612-94-6 |
Molecular Formula: | C151H228N40O47 |
Molecular Weight: | 3355.6658 |
MDL Number: | MFCD00167940 |
SMILES: | NCCCC[C@@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)NCC(=O)N[C@H](C(=O)NCC(=O)O)CCCNC(=N)N)CCCCN)C(C)C)CC(C)C)Cc1c[nH]c2c1cccc2)C)[C@H](CC)C)Cc1ccccc1)CCC(=O)O)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)CNC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](C(C)C)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H]([C@H](O)C)NC(=O)[C@@H](NC(=O)[C@H]([C@H](O)C)NC(=O)CNC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](Cc1[nH]cnc1)N)C)CCC(=O)O)Cc1ccccc1)CO)CC(=O)O)CO)CO)Cc1ccc(cc1)O)CC(C)C)CCC(=O)O)CCC(=O)N)C)C |
GLP-1(7-37) is a peptide hormone that has shown promising applications in chemical synthesis. This biologically active peptide plays a crucial role in regulating glucose metabolism and insulin secretion in the body. In chemical synthesis, GLP-1(7-37) can be utilized as a key building block for producing peptide derivatives with potential therapeutic benefits. By harnessing the unique properties of GLP-1(7-37), chemists can efficiently design and create novel peptide-based molecules for various applications in drug discovery and development. Additionally, the incorporation of GLP-1(7-37) into chemical synthesis strategies can lead to the development of new pharmaceutical compounds with enhanced biological activity and improved pharmacokinetic profiles.