AE13912
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $122.00 | $85.00 | - + | |
5g | 98% | in stock | $123.00 | $86.00 | - + | |
25g | 98% | in stock | $338.00 | $237.00 | - + | |
100g | 98% | in stock | $1,081.00 | $757.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE13912 |
Chemical Name: | BIS(TRIPHENYLPHOSPHINE)COPPER (I) NITRATE |
CAS Number: | 106678-35-7 |
Molecular Formula: | C36H30CuNO3P2 |
Molecular Weight: | 650.1218 |
MDL Number: | MFCD02091690 |
SMILES: | c1ccc(cc1)P(c1ccccc1)(c1ccccc1)[Cu+]P(c1ccccc1)(c1ccccc1)c1ccccc1.[O-][N+](=O)[O-] |
The bis(triphenylphosphine)copper(I) nitrate is a versatile reagent widely employed in chemical synthesis as a catalyst. Its ability to participate in a variety of reactions makes it a valuable tool for organic chemists seeking to streamline their synthetic methodologies. The complex is known to catalyze a range of transformations, including cross-coupling reactions, carbon-carbon bond formations, and cycloadditions. Additionally, its high stability and solubility in organic solvents enhance its utility in various reaction conditions. This compound plays a crucial role in facilitating the development of novel molecules and functional materials in the realm of organic synthesis.