AB51404
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $15.00 | $10.00 | - + | |
1g | 97% | in stock | $16.00 | $11.00 | - + | |
5g | 97% | in stock | $35.00 | $24.00 | - + | |
10g | 97% | in stock | $39.00 | $27.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB51404 |
Chemical Name: | Boc-D-Lys-OH |
CAS Number: | 106719-44-2 |
Molecular Formula: | C11H22N2O4 |
Molecular Weight: | 246.3034 |
MDL Number: | MFCD00076956 |
SMILES: | NCCCC[C@H](C(=O)O)NC(=O)OC(C)(C)C |
Complexity: | 261 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 8 |
XLogP3: | -1.6 |
Utilizing N2-[(1,1-Dimethylethoxy)carbonyl]-D-lysine in chemical synthesis offers a versatile and efficient approach to peptide synthesis. This compound acts as a valuable building block for constructing peptides, specifically in the solid-phase peptide synthesis method. Its N-terminal protecting group, the 1,1-Dimethylethoxy carbonyl (Dmoc) moiety, provides stability during peptide assembly while allowing for selective deprotection under mild conditions. N2-[(1,1-Dimethylethoxy)carbonyl]-D-lysine is particularly advantageous in synthesizing complex peptides with multiple sequences or modifications, enabling precise control over peptide chain elongation and functional group protection. This compound facilitates the creation of diverse peptide structures, making it an indispensable tool in the field of chemical synthesis.