AD41757
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
10mg | 95% | in stock | $79.00 | $55.00 | - + | |
25mg | 95% | in stock | $180.00 | $126.00 | - + | |
50mg | 95% | in stock | $301.00 | $211.00 | - + | |
100mg | 95% | in stock | $562.00 | $394.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD41757 |
Chemical Name: | GYY 4137 |
CAS Number: | 106740-09-4 |
Molecular Formula: | C15H25N2O3PS2 |
Molecular Weight: | 376.4744 |
MDL Number: | MFCD18428020 |
SMILES: | C1COCC[NH2+]1.COc1ccc(cc1)P(=S)(N1CCOCC1)[S-] |
Morpholine (4-methoxyphenyl)(morpholino)phosphinodithioate is a versatile compound widely used in chemical synthesis as a key intermediate for the preparation of organophosphorus compounds. With its unique structural properties, this compound serves as a valuable building block for the synthesis of various phosphorus-containing compounds with diverse applications.In chemical synthesis, Morpholine (4-methoxyphenyl)(morpholino)phosphinodithioate plays a crucial role in the development of new materials, pharmaceuticals, agrochemicals, and other specialty chemicals. Its phosphorus atom is particularly valuable for its ability to participate in a wide range of chemical reactions, making it a valuable component in the design of organic and organometallic molecules.Researchers and chemists utilize Morpholine (4-methoxyphenyl)(morpholino)phosphinodithioate in the preparation of phosphorus-containing ligands, catalysts, and inhibitors for applications in asymmetric synthesis, metal-catalyzed reactions, and biological studies. By incorporating this compound into their synthetic routes, chemists can tailor the properties and functions of the resulting molecules to meet specific requirements in various fields of chemistry.Overall, Morpholine (4-methoxyphenyl)(morpholino)phosphinodithioate serves as a versatile and indispensable tool in chemical synthesis, enabling the creation of novel compounds and the advancement of research and development in diverse areas of chemistry and beyond.