AD41649
Availability | ||
---|---|---|
Typically In Stock |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD41649 |
Chemical Name: | 4'-(Aminomethyl)-3',6'-dihydroxy-3H-spiro[isobenzofuran-1,9'-xanthen]-3-one |
CAS Number: | 106754-95-4 |
Molecular Formula: | C21H15NO5 |
Molecular Weight: | 361.3475 |
MDL Number: | MFCD23135523 |
SMILES: | NCc1c(O)ccc2c1Oc1cc(O)ccc1C12OC(=O)c2c1cccc2 |
The compound 4'-(Aminomethyl)-3',6'-dihydroxy-3H-spiro[isobenzofuran-1,9'-xanthen]-3-one holds significant value in chemical synthesis due to its versatile reactivity and structural features. Its presence of an aminomethyl group and multiple hydroxy groups provide unique opportunities for selective functionalization and derivatization in various synthetic pathways. In organic synthesis, this compound serves as a valuable building block for the construction of complex molecular architectures and the synthesis of biologically active compounds. Through strategic manipulation of its functional groups, it can participate in diverse chemical reactions like acylation, alkylation, and condensation reactions to create a wide array of novel organic compounds with potential pharmaceutical or material science applications. Additionally, the spiro[isobenzofuran-1,9'-xanthen]-3-one scaffold imparts distinctive structural properties, making it a valuable component in the design and synthesis of fluorescent dyes, molecular probes, and functional materials.