logo
Home  > Chemistry  > Heterocyclic Building Blocks  > Piperidines  > 1-Boc-3, 3-difluoro-4,4-(dihydroxy)piperidine

AB52377

1067914-83-3 | 1-Boc-3, 3-difluoro-4,4-(dihydroxy)piperidine

Packsize Purity Availability Price Discounted Price    Quantity
1g 95% in stock $10.00 $7.00 -   +
5g 95% in stock $30.00 $21.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AB52377
Chemical Name: 1-Boc-3, 3-difluoro-4,4-(dihydroxy)piperidine
CAS Number: 1067914-83-3
Molecular Formula: C10H17F2NO4
Molecular Weight: 253.2431
MDL Number: MFCD18072968
SMILES: O=C(N1CCC(C(C1)(F)F)(O)O)OC(C)(C)C

 

Computed Properties
Complexity: 312  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 17  
Hydrogen Bond Acceptor Count: 6  
Hydrogen Bond Donor Count: 2  
Rotatable Bond Count: 2  
XLogP3: 0.5  

 

 

Upstream Synthesis Route
  • The tert-Butyl 3,3-difluoro-4,4-dihydroxypiperidine-1-carboxylate is a versatile compound commonly used in chemical synthesis for its unique combination of functionality and reactivity. This compound serves as a valuable building block in the creation of various organic molecules due to its ability to participate in a wide range of chemical reactions.One of the primary applications of tert-Butyl 3,3-difluoro-4,4-dihydroxypiperidine-1-carboxylate is in the synthesis of pharmaceutical compounds. Its specific structural features make it an ideal starting material for the preparation of biologically active molecules, such as potential drug candidates. By utilizing this compound in the synthesis process, chemists can introduce specific functionalities and stereochemistry into the target molecules, ultimately influencing their pharmacological properties.Additionally, tert-Butyl 3,3-difluoro-4,4-dihydroxypiperidine-1-carboxylate can be employed in the creation of advanced materials with tailored properties. Its unique molecular structure allows for the modification of materials' physical and chemical characteristics, making it a valuable tool in the development of novel materials for various industrial applications.Overall, the application of tert-Butyl 3,3-difluoro-4,4-dihydroxypiperidine-1-carboxylate in chemical synthesis plays a crucial role in advancing the fields of drug discovery, materials science, and organic chemistry by enabling the efficient and precise construction of complex molecules and materials with desired properties.
FEATURED PRODUCTS