AD41432
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $22.00 | $16.00 | - + | |
250mg | 95% | in stock | $27.00 | $19.00 | - + | |
1g | 95% | in stock | $81.00 | $57.00 | - + | |
5g | 95% | in stock | $345.00 | $242.00 | - + | |
10g | 95% | in stock | $690.00 | $483.00 | - + | |
25g | 95% | in stock | $1,718.00 | $1,202.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD41432 |
Chemical Name: | 2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-(pent-4-en-1-yl)hept-6-enoic acid |
CAS Number: | 1068435-19-7 |
Molecular Formula: | C27H31NO4 |
Molecular Weight: | 433.5393 |
MDL Number: | MFCD12925762 |
SMILES: | C=CCCCC(C(=O)O)(NC(=O)OCC1c2ccccc2-c2c1cccc2)CCCC=C |
Complexity: | 624 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 32 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 13 |
XLogP3: | 6.1 |
2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-(pent-4-en-1-yl)hept-6-enoic acid, known for its versatile properties, finds crucial applications in chemical synthesis. This compound acts as a key intermediate in the synthesis of various pharmaceuticals, agrochemicals, and materials due to its unique structural features. Specifically, it serves as a building block in the creation of advanced drug candidates, enabling the modification of specific functional groups to enhance biological activity or target specificity. Furthermore, its strategic placement of reactive sites allows for the introduction of diverse molecular functionalities, facilitating the design of novel compounds with tailored properties. In synthetic chemistry, this compound plays a pivotal role in enabling the development of intricate organic molecules through sequential reactions, making it a valuable tool for researchers and manufacturers in the field.