106867-30-5 | Adenosine5'-(tetrahydrogen triphosphate), 2-chloro-2'-deoxy- (9CI)

Availability
Typically In Stock

Description

• Catalog Number: AD41415
• Chemical Name: Adenosine5'-(tetrahydrogen triphosphate), 2-chloro-2'-deoxy- (9CI)
• CAS Number: 106867-30-5
• Molecular Formula: C10H15ClN5O10P3
• Molecular Weight: 493.6279
• SMILES: O=P(OP(=O)(OP(=O)O)O)OC[C@H]1O[C@H](C[C@@H]1O)n1cnc2c1nc(Cl)nc2N

Upstream Synthesis Route

Adenosine5'-(tetrahydrogen triphosphate), 2-chloro-2'-deoxy- (9CI) is a valuable compound in chemical synthesis due to its unique properties and functional groups. This compound is commonly utilized as a phosphorylating agent in the synthesis of nucleic acids, specifically in the formation of phosphodiester bonds. It serves as a key building block for the modification and synthesis of nucleic acid analogs, which are essential in biological research and pharmaceutical development. Additionally, Adenosine5'-(tetrahydrogen triphosphate), 2-chloro-2'-deoxy- (9CI) plays a crucial role in enzymatic studies and in the development of nucleotide-based probes for investigating biological processes at the molecular level. Its precise reactivity and compatibility with various other chemical entities make it a versatile tool in the field of chemical synthesis, enabling researchers to explore new avenues in nucleic acid chemistry and biotechnology.