AD68059
Availability | ||
---|---|---|
Typically In Stock |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD68059 |
Chemical Name: | Undecasiloxane,1,1,1,3,3,5,5,7,7,9,9,11,11,13,13,15,15,17,17,19,19,21,21,21-tetracosamethyl- |
CAS Number: | 107-53-9 |
Molecular Formula: | C24H72O10Si11 |
Molecular Weight: | 829.763 |
SMILES: | C[Si](O[Si](O[Si](O[Si](O[Si](O[Si](C)(C)C)(C)C)(C)C)(C)C)(C)C)(O[Si](O[Si](O[Si](O[Si](O[Si](C)(C)C)(C)C)(C)C)(C)C)(C)C)C |
1,1,1,3,3,5,5,7,7,9,9,11,11,13,13,15,15,17,17,19,19,21,21,21-Tetracosamethylundecasiloxane is commonly utilized in chemical synthesis as a highly stable, low-viscosity silicone compound. Its unique molecular structure consisting of repeating silicon-oxygen bonds makes it an ideal building block for creating silicone polymers with specific properties. In chemical synthesis, this compound serves as a key ingredient in the production of various silicone-based materials such as adhesives, coatings, and sealants. Its exceptional thermal stability, chemical inertness, and water-repellent properties make it a valuable component in the formulation of innovative products for a wide range of industries including electronics, automotive, and construction.