1070798-99-0 | 2,5-Dioxopyrrolidin-1-yl 2-oxo-6,9,12,15,18,21,24,27-octaoxa-3-thiatriacontan-30-oate

Packsize	Purity	Availability	Price	Discounted Price
100mg		2 weeks	$1,818.00	$1,273.00
1g		2 weeks	$5,167.00	$3,617.00

Description

• Catalog Number: AO81197
• Chemical Name: 2,5-Dioxopyrrolidin-1-yl 2-oxo-6,9,12,15,18,21,24,27-octaoxa-3-thiatriacontan-30-oate
• CAS Number: 1070798-99-0
• Molecular Formula: C25H43NO13S
• Molecular Weight: 597.6728199999999
• MDL Number: MFCD11041104
• SMILES: O=C(ON1C(=O)CCC1=O)CCOCCOCCOCCOCCOCCOCCOCCOCCSC(=O)C

Upstream Synthesis Route

The compound $name$ is commonly used in chemical synthesis for its versatile properties. This compound plays a crucial role in organic chemistry reactions as a key building block, enabling the formation of complex molecular structures. Its unique chemical structure allows for precise manipulation and modification, making it valuable in creating novel compounds with specific functionalities. $name$ is particularly utilized in the synthesis of pharmaceuticals, agrochemicals, and advanced materials due to its ability to introduce multiple reactive sites for further derivatization. Additionally, its high purity and stability make it a reliable reagent for various synthetic pathways, facilitating the creation of diverse chemical compounds with tailored properties. By incorporating $name$ into synthetic routes, chemists can efficiently produce a wide range of target molecules for research and industrial applications.