AE12552
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $25.00 | $17.00 | - + | |
5g | 95% | in stock | $70.00 | $49.00 | - + | |
10g | 95% | in stock | $89.00 | $62.00 | - + | |
25g | 95% | in stock | $201.00 | $141.00 | - + | |
100g | 95% | in stock | $665.00 | $466.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE12552 |
Chemical Name: | R-(-)-2-Benzylamino-1-phenylethanol |
CAS Number: | 107171-75-5 |
Molecular Formula: | C15H17NO |
Molecular Weight: | 227.3016 |
MDL Number: | MFCD03427122 |
SMILES: | O[C@H](c1ccccc1)CNCc1ccccc1 |
The (R)-2-Benzylamino-1-phenylethanol is a versatile compound often utilized in chemical synthesis for its unique properties and reactivity. Its chiral nature, stemming from the presence of the stereocenter in the molecule, makes it a valuable building block in the synthesis of various pharmaceuticals, agrochemicals, and other fine chemicals.One key application of (R)-2-Benzylamino-1-phenylethanol is its use as a chiral auxiliary in asymmetric synthesis. By incorporating this compound into a synthetic pathway, chemists can selectively control the stereochemistry of the final product, leading to the formation of single enantiomers with high optical purity. This is particularly crucial in the pharmaceutical industry, where the biological activity of a drug often depends on the specific arrangement of chiral centers.Furthermore, (R)-2-Benzylamino-1-phenylethanol can serve as a precursor for the synthesis of various biologically active compounds. Its benzylamino and phenylethanol moieties can undergo a range of chemical transformations, such as oxidation, reduction, and functional group interconversions, enabling the introduction of diverse functional groups into the molecular structure. This versatility makes it an essential building block in the design and development of new molecules with desired properties.Overall, the (R)-2-Benzylamino-1-phenylethanol plays a crucial role in advancing the field of chemical synthesis by providing a valuable tool for the controlled construction of complex organic molecules with high stereochemical precision. Its applications extend across various industries, contributing to the discovery and production of novel compounds with potential therapeutic, agricultural, and industrial applications.