logo
Home  > 4-(4-Amino-phenylamino)-piperidine-1-carboxylic acid tert-butyl ester

AD64295

1071932-29-0 | 4-(4-Amino-phenylamino)-piperidine-1-carboxylic acid tert-butyl ester

Packsize Purity Availability Price Discounted Price    Quantity
100mg 95% in stock $96.00 $68.00 -   +
250mg 95% in stock $164.00 $115.00 -   +
500mg 95% in stock $264.00 $185.00 -   +
1g 95% in stock $449.00 $315.00 -   +
2.5g 95% in stock $886.00 $620.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AD64295
Chemical Name: 4-(4-Amino-phenylamino)-piperidine-1-carboxylic acid tert-butyl ester
CAS Number: 1071932-29-0
Molecular Formula: C16H25N3O2
Molecular Weight: 291.3886
MDL Number: MFCD12026437
SMILES: O=C(N1CCC(CC1)Nc1ccc(cc1)N)OC(C)(C)C

 

Upstream Synthesis Route 
  • 4-(4-amino-phenylamino)-piperidine-1-carboxylic acid tert-butyl ester is a versatile compound utilized in chemical synthesis for various applications. In organic chemistry, this compound serves as a key building block for the synthesis of complex molecules and pharmaceutical compounds. Its unique structure allows for the introduction of specific functional groups and stereochemistry, making it a valuable tool in the design and creation of new chemical entities. Additionally, the tert-butyl ester group provides protection against unwanted reactions, allowing for selective manipulations during the synthesis process. Overall, the compound plays a crucial role in the development of novel compounds with potential applications across different fields of chemistry.
FEATURED PRODUCTS