logo
Home  > N-(3-(Aminomethyl)pyridin-2-yl)-n-methylmethanesulfonamide acetate

AE27121

1073159-75-7 | N-(3-(Aminomethyl)pyridin-2-yl)-n-methylmethanesulfonamide acetate

Packsize Purity Availability Price Discounted Price    Quantity
25mg 95% in stock $26.00 $18.00 -   +
100mg 95% in stock $78.00 $55.00 -   +
1g 95% in stock $727.00 $509.00 -   +
5g 95% in stock $2,514.00 $1,760.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AE27121
Chemical Name: N-(3-(Aminomethyl)pyridin-2-yl)-n-methylmethanesulfonamide acetate
CAS Number: 1073159-75-7
Molecular Formula: C10H17N3O4S
Molecular Weight: 275.3247
MDL Number: MFCD29044904
SMILES: CC(=O)O.NCc1cccnc1N(S(=O)(=O)C)C

 

Upstream Synthesis Route 
  • The compound N-(3-(Aminomethyl)pyridin-2-yl)-N-methylmethanesulfonamide acetate serves as a valuable tool in chemical synthesis due to its versatile applications. With its unique structure, this compound is often utilized as a key building block in the creation of various organic molecules. Its functionality allows for the introduction of specific functional groups into target molecules, enabling chemists to design and synthesize complex compounds with precision. Additionally, the acetate form of the compound provides stability and ease of handling during reactions, making it a preferred choice in synthetic chemistry. Whether used in pharmaceutical research, material science, or other fields, this compound plays a crucial role in advancing the development of new molecules and materials with tailored properties.
FEATURED PRODUCTS