AB77071
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 96% | in stock | $106.00 | $75.00 | - + | |
1g | 96% | in stock | $251.00 | $176.00 | - + | |
5g | 96% | in stock | $869.00 | $608.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB77071 |
Chemical Name: | N-Benzyl-N-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
CAS Number: | 1073354-30-9 |
Molecular Formula: | C19H25BN2O2 |
Molecular Weight: | 324.225 |
MDL Number: | MFCD06798271 |
SMILES: | CN(c1ccc(cn1)B1OC(C(O1)(C)C)(C)C)Cc1ccccc1 |
Complexity: | 408 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 24 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 4 |
N-Benzyl-N-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine is a versatile compound commonly used in chemical synthesis as a key building block for the creation of various organic molecules. Its unique structure allows for efficient and selective cross-coupling reactions, making it an essential tool in the formation of complex chemical structures. This compound is particularly valuable in the synthesis of pharmaceuticals, agrochemicals, and materials science due to its ability to facilitate the construction of carbon-carbon and carbon-heteroatom bonds with high precision and control. Its compatibility with a wide range of reaction conditions and substrates further enhances its utility in the development of novel chemical compounds with diverse applications.