AB63196
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $66.00 | $46.00 | - + | |
1g | 95% | in stock | $136.00 | $95.00 | - + | |
5g | 95% | in stock | $386.00 | $270.00 | - + | |
25g | 95% | in stock | $1,131.00 | $792.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB63196 |
Chemical Name: | 1-(Toluene-4-sulfonyl)-1H-indole-3-boronic acid pinacol ester |
CAS Number: | 1073354-51-4 |
Molecular Formula: | C21H24BNO4S |
Molecular Weight: | 397.2956 |
MDL Number: | MFCD08063118 |
SMILES: | Cc1ccc(cc1)S(=O)(=O)n1cc(c2c1cccc2)B1OC(C(O1)(C)C)(C)C |
Complexity: | 665 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 28 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 3 |
1-[(4-Methylphenyl)sulfonyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole is a versatile compound that finds significant utility in chemical synthesis. This compound serves as an excellent building block in the organic synthesis of various complex molecules due to its unique structural features. The sulfonyl group on the phenyl ring provides a site for further functionalization, allowing for the introduction of diverse chemical moieties. The dioxaborolane group is a valuable boron-containing unit that enables efficient cross-coupling reactions with various organic electrophiles, making 1-[(4-Methylphenyl)sulfonyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole a powerful tool in the construction of carbon-carbon and carbon-heteroatom bonds.Furthermore, the presence of the indole moiety enhances the compound's reactivity and imparts biological activity to the synthesized molecules, making it particularly valuable in medicinal chemistry research and drug discovery efforts. In conclusion, the strategic incorporation of 1-[(4-Methylphenyl)sulfonyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole in chemical synthesis enables the efficient assembly of structurally diverse and biologically relevant compounds.