AD68274
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 96% | in stock | $7.00 | $5.00 | - + | |
1g | 96% | in stock | $14.00 | $10.00 | - + | |
5g | 96% | in stock | $45.00 | $32.00 | - + | |
100g | 96% | in stock | $760.00 | $532.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD68274 |
Chemical Name: | 2-Amino-5-chlorophenylboronic acid, pinacol ester |
CAS Number: | 1073371-77-3 |
Molecular Formula: | C12H17BClNO2 |
Molecular Weight: | 253.5329 |
MDL Number: | MFCD06795672 |
SMILES: | CC1(C)OB(OC1(C)C)c1cc(Cl)ccc1N |
Complexity: | 282 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
2-Amino-5-chlorophenylboronic acid pinacol ester, a versatile chemical compound commonly used in organic synthesis, plays a crucial role in the development of pharmaceuticals and agrochemicals. With its unique structure and reactivity, this compound serves as a key building block in the synthesis of diverse biologically active molecules. Specifically, 2-Amino-5-chlorophenylboronic acid pinacol ester is frequently employed in Suzuki-Miyaura cross-coupling reactions to form carbon-carbon bonds, enabling the creation of complex molecular structures with high efficiency. Furthermore, its compatibility with various functional groups and mild reaction conditions make it a valuable tool for chemists in the synthesis of novel compounds for medicinal and agricultural applications.