AB65734
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 96% | in stock | $119.00 | $84.00 | - + | |
1g | 96% | in stock | $417.00 | $292.00 | - + | |
5g | 96% | in stock | $1,317.00 | $922.00 | - + | |
10g | 96% | in stock | $2,313.00 | $1,619.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB65734 |
Chemical Name: | 5-Methyl-6-morpholinylpyridine-3-boronic acid pinacol ester |
CAS Number: | 1073372-03-8 |
Molecular Formula: | C16H25BN2O3 |
Molecular Weight: | 304.1923 |
MDL Number: | MFCD09037483 |
SMILES: | Cc1cc(cnc1N1CCOCC1)B1OC(C(O1)(C)C)(C)C |
Complexity: | 383 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 22 |
Hydrogen Bond Acceptor Count: | 5 |
Rotatable Bond Count: | 2 |
4-(3-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-yl)morpholine is a highly versatile compound used in chemical synthesis for the construction of complex organic molecules. This molecule serves as a key building block in the development of pharmaceuticals, agrochemicals, and materials science. Its unique structure allows for precise control over the functional groups and stereochemistry of the final products. By incorporating 4-(3-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-yl)morpholine into synthetic pathways, chemists can access a wide range of novel compounds with potential applications in various industries.