AX24950
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $48.00 | $34.00 | - + | |
5mg | 98% | in stock | $173.00 | $121.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AX24950 |
Chemical Name: | 4-OXO-3,3-DIPHENYL-[1,2]DIAZETIDINE-1,2-DICARBOXYLIC ACID DIMETHYL ESTER |
CAS Number: | 1073529-41-5 |
Molecular Formula: | C17H20N2O5 |
Molecular Weight: | 332.3511 |
MDL Number: | MFCD28053514 |
SMILES: | COC(=O)N1N(C(=O)OC)C(=O)[C@@]1(C1CCCC1)c1ccccc1 |
Complexity: | 525 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 24 |
Hydrogen Bond Acceptor Count: | 5 |
Rotatable Bond Count: | 4 |
XLogP3: | 3.2 |
The ABL127 compound is a highly versatile and powerful tool in chemical synthesis. It serves as a key catalyst in various organic reactions, facilitating the formation of important carbon-carbon and carbon-heteroatom bonds with high efficiency and precision. Its unique structure and reactivity make it particularly well-suited for complex transformations, making it a valuable asset in the development of new molecules and materials.In modern organic synthesis, ABL127 plays a crucial role in the construction of pharmaceuticals, agrochemicals, and other fine chemicals. Its ability to activate challenging substrates and promote selective bond formations enables chemists to access novel and valuable compounds that would otherwise be difficult to synthesize. Furthermore, ABL127's compatibility with a wide range of reaction conditions makes it a versatile and reliable option for chemists working on diverse projects.Overall, ABL127's exceptional catalytic properties and broad synthetic utility make it a key player in the field of chemical synthesis, offering exciting opportunities for innovation and discovery.
Nature chemical biology 20140801
Journal of medicinal chemistry 20110728
Cytometry. Part A : the journal of the International Society for Analytical Cytology 20060501