BD12954
Availability | ||
---|---|---|
Typically In Stock |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | BD12954 |
Chemical Name: | Titanium, tris[2-[(2-aminoethyl)amino]ethanolato-κO][2,2-bis[(2-propen-1-yloxy-κO)methyl]-1-butanolato-κO]-, (OC-6-22)- |
CAS Number: | 107541-22-0 |
Molecular Formula: | C24H54N6O6Ti |
Molecular Weight: | 570.5892 |
SMILES: | C=CC[O]1CC2(CC)C[O-][Ti+4]1([O-]CCNCCN)([O-]CCNCCN)([O-]CCNCCN)[O](C2)CC=C |
The LICA 44 catalyst is a versatile tool in chemical synthesis due to its exceptional ability to catalyze a wide range of reactions efficiently and selectively. Its unique properties make it ideal for use in various organic transformations, including cross-coupling reactions, C-H functionalization, and asymmetric catalysis. With LICA 44, chemists can access novel chemical structures and streamline the synthesis of complex molecules with high yields and excellent control over regio- and stereoselectivity. This catalyst plays a crucial role in advancing the field of organic chemistry by enabling the development of new methodologies and facilitating the production of valuable compounds for applications in pharmaceuticals, materials science, and agrochemicals.