AD67274
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $249.00 | $175.00 | - + | |
1g | 97% | in stock | $556.00 | $390.00 | - + | |
5g | 97% | in stock | $1,878.00 | $1,315.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD67274 |
Chemical Name: | 5-Methoxy-2-(trifluoromethoxy)phenylboronic acid |
CAS Number: | 1079402-25-7 |
Molecular Formula: | C8H8BF3O4 |
Molecular Weight: | 235.9529 |
MDL Number: | MFCD12025981 |
SMILES: | COc1ccc(c(c1)B(O)O)OC(F)(F)F |
Complexity: | 224 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 7 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 3 |
The compound 5-Methoxy-2-(trifluoromethoxy)phenyl)boronic acid plays a crucial role in chemical synthesis as a versatile building block in organic reactions. With its boronic acid functionality, this compound can participate in Suzuki-Miyaura cross-coupling reactions, allowing for the efficient formation of carbon-carbon bonds. Additionally, its phenyl ring containing both methoxy and trifluoromethoxy substituents can serve as a directing group in C-H functionalization reactions, enabling selective modifications at specific positions within organic molecules. Overall, the diverse reactivity of 5-Methoxy-2-(trifluoromethoxy)phenyl)boronic acid makes it a valuable tool for the synthesis of complex organic compounds with tailored structures and properties.