AB44262
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 97% | in stock | $20.00 | $14.00 | - + | |
250mg | 97% | in stock | $35.00 | $24.00 | - + | |
1g | 97% | in stock | $61.00 | $43.00 | - + | |
5g | 97% | in stock | $241.00 | $169.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB44262 |
Chemical Name: | 3-(Dicyanomethylidene)indan-1-one |
CAS Number: | 1080-74-6 |
Molecular Formula: | C12H6N2O |
Molecular Weight: | 194.1888 |
MDL Number: | MFCD00143117 |
SMILES: | N#CC(=C1CC(=O)c2c1cccc2)C#N |
Complexity: | 411 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 3 |
XLogP3: | 1.1 |
3-(Dicyanomethylidene)indan-1-one is a versatile compound commonly used in chemical synthesis for its unique properties. In organic synthesis, this compound serves as a valuable building block for the construction of various complex molecules. Its electron-withdrawing dicyanomethylidene group facilitates reactions with nucleophiles, making it an essential intermediary in the formation of diverse chemical structures. Additionally, the indan-1-one scaffold provides rigidity and structural diversity, making it an ideal starting point for the development of novel organic compounds with tailored physical and chemical properties. Its application extends to the synthesis of pharmaceuticals, agrochemicals, and materials science, highlighting its significance in modern chemical research and development.