logo
Home  > Chemistry  > Organic Building Blocks  > Alkenyls  > 3-(Dicyanomethylidene)indan-1-one

AB44262

1080-74-6 | 3-(Dicyanomethylidene)indan-1-one

Packsize Purity Availability Price Discounted Price    Quantity
100mg 97% in stock $20.00 $14.00 -   +
250mg 97% in stock $35.00 $24.00 -   +
1g 97% in stock $61.00 $43.00 -   +
5g 97% in stock $241.00 $169.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AB44262
Chemical Name: 3-(Dicyanomethylidene)indan-1-one
CAS Number: 1080-74-6
Molecular Formula: C12H6N2O
Molecular Weight: 194.1888
MDL Number: MFCD00143117
SMILES: N#CC(=C1CC(=O)c2c1cccc2)C#N

 

Computed Properties
Complexity: 411  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 15  
Hydrogen Bond Acceptor Count: 3  
XLogP3: 1.1  

 

 

Upstream Synthesis Route
  • 3-(Dicyanomethylidene)indan-1-one is a versatile compound commonly used in chemical synthesis for its unique properties. In organic synthesis, this compound serves as a valuable building block for the construction of various complex molecules. Its electron-withdrawing dicyanomethylidene group facilitates reactions with nucleophiles, making it an essential intermediary in the formation of diverse chemical structures. Additionally, the indan-1-one scaffold provides rigidity and structural diversity, making it an ideal starting point for the development of novel organic compounds with tailored physical and chemical properties. Its application extends to the synthesis of pharmaceuticals, agrochemicals, and materials science, highlighting its significance in modern chemical research and development.
FEATURED PRODUCTS