AD43653
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 96% | in stock | $8.00 | $5.00 | - + | |
250mg | 96% | in stock | $16.00 | $11.00 | - + | |
1g | 96% | in stock | $17.00 | $12.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD43653 |
Chemical Name: | ethyl 5-bromo-1H-indazole-3-carboxylate |
CAS Number: | 1081-04-5 |
Molecular Formula: | C10H9BrN2O2 |
Molecular Weight: | 269.0947 |
MDL Number: | MFCD05663980 |
SMILES: | CCOC(=O)c1n[nH]c2c1cc(Br)cc2 |
Complexity: | 250 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 2.8 |
Ethyl 5-bromo-1H-indazole-3-carboxylate is a valuable chemical compound that finds application in organic synthesis as a versatile building block. It serves as a key intermediate in the preparation of various biologically active molecules and pharmaceuticals. This compound is used in the synthesis of diverse heterocyclic compounds with potential pharmaceutical, agrochemical, and material science applications. The presence of the bromo substituent in the 5-position of the indazole ring provides a handle for further functionalization, enabling the introduction of various substituents to modulate the compound's properties. Its versatility and reactivity make it a crucial component in the development of new chemical entities with desired biological activities.