AD43359
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $76.00 | $53.00 | - + | |
1g | 95% | in stock | $193.00 | $135.00 | - + | |
5g | 95% | in stock | $604.00 | $423.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD43359 |
Chemical Name: | 1-Phenylpiperidin-4-amine dihydrochloride |
CAS Number: | 1082662-38-1 |
Molecular Formula: | C11H18Cl2N2 |
Molecular Weight: | 249.18 |
MDL Number: | MFCD23135281 |
SMILES: | NC1CCN(CC1)c1ccccc1.Cl.Cl |
Complexity: | 144 |
Covalently-Bonded Unit Count: | 3 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 1 |
1-Phenylpiperidin-4-amine dihydrochloride is a versatile intermediate used in chemical synthesis for various applications. With its unique structure and functional groups, this compound plays a crucial role in the creation of complex organic molecules. It serves as a key building block in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals. The presence of the piperidine ring and amine group in its structure allows for diverse chemical transformations, making it valuable for designing and constructing new compounds. In the field of medicinal chemistry, 1-Phenylpiperidin-4-amine dihydrochloride is particularly significant for drug discovery and development, as it can be modified to impart specific biological activities or enhance pharmacokinetic properties. Its application in chemical synthesis extends to the creation of polymers, catalysts, and other specialty chemicals, highlighting its importance in advancing modern technology and research efforts.