AE11150
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | 2 weeks | $63.00 | $44.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE11150 |
Chemical Name: | tert-Butyl 3-(3-methylpyridin-2-yl)benzoate |
CAS Number: | 1083057-12-8 |
Molecular Formula: | C17H19NO2 |
Molecular Weight: | 269.3383 |
MDL Number: | MFCD26383927 |
SMILES: | O=C(c1cccc(c1)c1ncccc1C)OC(C)(C)C |
Complexity: | 334 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 4 |
XLogP3: | 3.7 |
Tert-Butyl 3-(3-methylpyridin-2-yl)benzoate is a versatile compound widely used in chemical synthesis as a valuable building block. Its unique structure allows for a broad range of applications in the field of organic chemistry.This compound is commonly employed as a key intermediate in the synthesis of various pharmaceuticals, agrochemicals, and specialty chemicals. It serves as a crucial starting material for the preparation of complex molecules due to its reactivity and compatibility with a variety of synthetic pathways.In chemical synthesis, tert-Butyl 3-(3-methylpyridin-2-yl)benzoate plays a significant role in the construction of heterocyclic compounds, which are essential in drug discovery and development. Its incorporation into the molecular framework of target compounds imparts desired properties and biological activities, making it an indispensable tool in medicinal chemistry.Furthermore, this compound can be utilized in the synthesis of novel materials, such as polymers and functionalized organic molecules, driving innovation in diverse industrial sectors. Its strategic placement of functional groups offers opportunities for further diversification and modification, enhancing its utility in designing advanced materials.Overall, tert-Butyl 3-(3-methylpyridin-2-yl)benzoate is a valuable synthetic intermediate that enables the efficient and rational design of complex molecules with tailored properties, making it an essential component in modern chemical synthesis strategies.