AE10776
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | ≥95% | in stock | $96.00 | $67.00 | - + | |
10mg | 98% | in stock | $103.00 | $72.00 | - + | |
25mg | 98% | in stock | $174.00 | $122.00 | - + | |
100mg | 98% | in stock | $446.00 | $312.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE10776 |
Chemical Name: | UDP-ALPHA-D-N-ACETYLGALACTOSAMINE, DISODIUM SALT |
CAS Number: | 108320-87-2 |
Molecular Formula: | C17H25N3Na2O17P2 |
Molecular Weight: | 651.3174 |
MDL Number: | MFCD00077894 |
SMILES: | OC[C@H]1O[C@H](OP(=O)(OP(=O)(OC[C@H]2O[C@H]([C@@H]([C@@H]2O)O)n2ccc(=O)[nH]c2=O)[O-])[O-])[C@@H]([C@H]([C@H]1O)O)NC(=O)C.[Na+].[Na+] |
$Name$ is a crucial compound in chemical synthesis due to its versatile applications. It serves as a key building block in the creation of complex molecules, particularly in the field of carbohydrate chemistry. Its unique properties make it a valuable tool for researchers and chemists looking to develop new drugs, materials, and bioconjugates. With its ability to act as a precursor for various glycans and glycoconjugates, $Name$ plays a fundamental role in the synthesis of glycoproteins, glycolipids, and other biologically important compounds. Chemists utilize $Name$ in the modification of proteins and peptides, as well as in the study of glycosylation processes. Its compatibility with a wide range of reaction conditions makes it a versatile reagent for achieving sophisticated chemical transformations. In summary, the application of Udp-alpha-d-n-acetylgalactosamine, disodium salt in chemical synthesis is pivotal for advancing our understanding of complex biological processes and creating innovative molecules with diverse functions.