AE16386
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 97% | in stock | $75.00 | $53.00 | - + | |
250mg | 97% | in stock | $130.00 | $91.00 | - + | |
1g | 97% | in stock | $344.00 | $241.00 | - + | |
5g | 97% | in stock | $1,646.00 | $1,153.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE16386 |
Chemical Name: | N-[2-Methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-methanesulfonamide |
CAS Number: | 1083326-75-3 |
Molecular Formula: | C13H21BN2O5S |
Molecular Weight: | 328.1922 |
MDL Number: | MFCD12964555 |
SMILES: | COc1ncc(cc1NS(=O)(=O)C)B1OC(C(O1)(C)C)(C)C |
Complexity: | 489 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 22 |
Hydrogen Bond Acceptor Count: | 7 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 4 |
N-(2-Methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-yl)methanesulfonamide serves as a valuable building block in chemical synthesis due to its unique properties and reactivity. This compound is commonly used as a key reagent in Suzuki-Miyaura cross-coupling reactions, facilitating the formation of C-C bonds under mild conditions. Its boron functionality allows for efficient incorporation into various organic structures, making it a versatile tool for the synthesis of complex molecules. Additionally, the methoxy and pyridine moieties provide additional structural diversity and potential for further derivatization, enhancing the compound's utility in the creation of diverse chemical libraries and pharmaceutical intermediates.