logo
Home  > Carbonic acid,di(methyl-d3) ester (6CI)

AI07434

108481-44-3 | Carbonic acid,di(methyl-d3) ester (6CI)

Packsize Purity Availability Price Discounted Price    Quantity
1g 98% 1 week $548.00 $383.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AI07434
Chemical Name: Carbonic acid,di(methyl-d3) ester (6CI)
CAS Number: 108481-44-3
Molecular Formula: C3D6O3
Molecular Weight: 96.1149
MDL Number: MFCD01073488
SMILES: [2H]C(OC(=O)OC([2H])([2H])[2H])([2H])[2H]

 

Upstream Synthesis Route
  • Dimethyl-d6 carbonate is a versatile compound widely utilized in chemical synthesis processes. This isotopically labeled compound plays a crucial role in various applications due to its unique properties. In chemical synthesis, Dimethyl-d6 carbonate serves as a key reagent for the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals. Its high purity and isotopic labeling enable precise tracking of reaction pathways and identification of reaction intermediates. The use of Dimethyl-d6 carbonate in chemical synthesis ensures improved efficiency, yield, and selectivity of the desired products. Additionally, its compatibility with a wide range of reaction conditions makes it an essential tool for organic chemists and researchers in the field.
FEATURED PRODUCTS