AE08794
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5mg | 98% | in stock | $57.00 | $40.00 | - + | |
10mg | 98% | in stock | $108.00 | $76.00 | - + | |
25mg | 98% | in stock | $164.00 | $115.00 | - + | |
100mg | 98% | in stock | $580.00 | $406.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE08794 |
Chemical Name: | CIS-7,10,13,16,19-DOCOSAPENTAENOIC ACID METHYL ESTER |
CAS Number: | 108698-02-8 |
Molecular Formula: | C23H36O2 |
Molecular Weight: | 344.5307 |
MDL Number: | MFCD00674894 |
SMILES: | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC |
Methyl (7Z,10Z,13Z,16Z,19Z)-7,10,13,16,19-docosapentaenoate is a versatile compound that finds significant utility in chemical synthesis. This particular methyl ester derivative of docosapentaenoic acid serves as a crucial building block in the creation of various advanced materials and compounds. Its unique structure, characterized by multiple conjugated double bonds, makes it particularly valuable in synthetic chemistry applications.In chemical synthesis, Methyl (7Z,10Z,13Z,16Z,19Z)-7,10,13,16,19-docosapentaenoate can be utilized as a precursor in the production of specialized lipids, polymers, and pharmaceutical intermediates. Its reactive double bonds offer opportunities for further functionalization through various chemical transformations, enabling the creation of tailored molecules with specific properties and functions. This compound's compatibility with a wide range of synthetic methodologies makes it a valuable tool for researchers and chemists seeking to design and construct complex molecular structures for diverse applications.Overall, the application of Methyl (7Z,10Z,13Z,16Z,19Z)-7,10,13,16,19-docosapentaenoate in chemical synthesis showcases its importance as a key component in the synthesis of innovative materials and compounds with potential implications across industries such as pharmaceuticals, materials science, and biotechnology.