AE11299
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 95% | 1 week | $57.00 | $40.00 | - + | |
5mg | 95% | 1 week | $135.00 | $94.00 | - + | |
10mg | 95% | 1 week | $217.00 | $152.00 | - + | |
25mg | 95% | 1 week | $501.00 | $351.00 | - + | |
50mg | 95% | 1 week | $740.00 | $518.00 | - + | |
100mg | 95% | 1 week | $1,052.00 | $737.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE11299 |
Chemical Name: | Nemorubicin |
CAS Number: | 108852-90-0 |
Molecular Formula: | C32H37NO13 |
Molecular Weight: | 643.6351 |
MDL Number: | MFCD00871079 |
SMILES: | CO[C@H]1OCCN(C1)[C@H]1C[C@@H](O[C@H]([C@H]1O)C)O[C@H]1C[C@@](O)(Cc2c1c(O)c1c(c2O)C(=O)c2c(C1=O)c(OC)ccc2)C(=O)CO |
Nemorubicin is a potent anthracycline antibiotic derived from the natural product, neothramycin B. In chemical synthesis, Nemorubicin serves as a valuable intermediate for the preparation of various organic compounds and pharmaceuticals. Due to its unique chemical structure, Nemorubicin exhibits remarkable anticancer properties, making it an important tool in the development of novel cancer treatments. Researchers and chemists often utilize Nemorubicin as a key building block in the synthesis of targeted anticancer drugs, allowing for the creation of more effective and selective therapies. Its versatility and efficacy in chemical transformations make Nemorubicin a versatile and indispensable compound in the realm of medicinal chemistry and drug discovery.