AX64466
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $36.00 | $25.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AX64466 |
Chemical Name: | LY2510924 |
CAS Number: | 1088715-84-7 |
Molecular Formula: | C62H88N14O10 |
Molecular Weight: | 1189.4499 |
MDL Number: | MFCD31728513 |
SMILES: | NC(=N)NCCC[C@H]1NC(=O)[C@H](CCCCNC(C)C)NC(=O)[C@H](Cc2ccc(cc2)O)NC(=O)[C@@H](NC(=O)CC[C@@H](NC(=O)CNC(=O)[C@@H](NC1=O)Cc1ccc2c(c1)cccc2)C(=O)N[C@H](C(=O)N)CCCCNC(C)C)Cc1ccccc1 |
LY2510924 is a novel chemical compound that has garnered significant attention in the field of chemical synthesis due to its unique and versatile properties. As a potent inhibitor of the lysophosphatidic acid receptor 1 (LPAR1), LY2510924 effectively modulates cellular signaling pathways involved in various physiological processes.In chemical synthesis, LY2510924 is utilized as a valuable tool for studying receptor-ligand interactions and elucidating the underlying mechanisms of signal transduction. Its ability to selectively target LPAR1 makes it a promising candidate for designing and developing new therapeutic agents targeting related pathways.Furthermore, the distinct molecular structure of LY2510924 offers opportunities for derivatization and structural modifications to generate analogs with enhanced biological activities or desired pharmacokinetic properties. Its application in chemical synthesis extends beyond basic research, with the potential to contribute to the discovery of novel drug candidates and lead compounds with improved efficacy and selectivity.Overall, LY2510924 represents a promising addition to the toolbox of chemists and researchers engaged in exploring the intricate networks of cellular signaling and molecular interactions, paving the way for innovative advancements in drug discovery and development.