logo
Home  > Z-(r,s)-3-amino-2-oxo-5-phenyl-1,4-benzodiazepine

AE11408

108895-98-3 | Z-(r,s)-3-amino-2-oxo-5-phenyl-1,4-benzodiazepine

Packsize Purity Availability Price Discounted Price    Quantity
250mg 98% in stock $209.00 $146.00 -   +
1g 98% in stock $405.00 $283.00 -   +
5g 98% in stock $1,452.00 $1,017.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AE11408
Chemical Name: Z-(r,s)-3-amino-2-oxo-5-phenyl-1,4-benzodiazepine
CAS Number: 108895-98-3
Molecular Formula: C23H19N3O3
Molecular Weight: 385.4153
MDL Number: MFCD01074700
SMILES: O=C(NC1N=C(c2ccccc2)c2c(NC1=O)cccc2)OCc1ccccc1

 

Upstream Synthesis Route 
  • The Benzyl (2-oxo-5-phenyl-2,3-dihydro-1H-benzo[e][1,4]diazepin-3-yl)carbamate compound plays a crucial role in chemical synthesis, particularly in the creation of novel pharmaceutical agents and functional materials. Its unique structural properties make it a versatile building block for constructing complex organic molecules with diverse applications in medicinal chemistry and materials science. This compound can undergo various chemical transformations, such as derivatization, functionalization, and cyclization reactions, enabling the synthesis of structurally diverse compounds with potential biological activities or material properties. Its introduction in a synthetic pathway can lead to the development of innovative drug candidates, agrochemicals, or advanced materials with tailored properties for specific applications in the pharmaceutical, agricultural, or materials industries.
FEATURED PRODUCTS