logo
Home  > Sodium 3-(3,4-dihydroxyphenyl)-2-oxopropanoate

AI07592

109170-71-0 | Sodium 3-(3,4-dihydroxyphenyl)-2-oxopropanoate

Availability
Typically In Stock

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AI07592
Chemical Name: Sodium 3-(3,4-dihydroxyphenyl)-2-oxopropanoate
CAS Number: 109170-71-0
Molecular Formula: C9H7NaO5
Molecular Weight: 218.1386
MDL Number: MFCD08460177
SMILES: [O-]C(=O)C(=O)Cc1ccc(c(c1)O)O.[Na+]

 

Upstream Synthesis Route
  • Sodium 3-(3,4-dihydroxyphenyl)-2-oxopropanoate is a versatile compound widely utilized in chemical synthesis processes. Its primary application lies in its role as a key intermediate in the synthesis of various pharmaceuticals and organic compounds. This compound serves as a valuable building block for the creation of diverse chemical structures, allowing for the efficient production of a range of bioactive molecules and complex materials. In chemical synthesis, Sodium 3-(3,4-dihydroxyphenyl)-2-oxopropanoate plays a crucial role in facilitating multi-step reactions by enabling the incorporation of specific functional groups and enhancing the overall efficiency of synthetic pathways. Its unique properties make it an indispensable component in the creation of innovative chemical products with diverse applications in both the pharmaceutical and industrial sectors.
FEATURED PRODUCTS