AE12076
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 97% | in stock | $19.00 | $14.00 | - + | |
250mg | 97% | in stock | $44.00 | $31.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE12076 |
Chemical Name: | 7-Bromoindazole-1-carboxylic acid tert-butyl ester |
CAS Number: | 1092352-37-8 |
Molecular Formula: | C12H13BrN2O2 |
Molecular Weight: | 297.1478 |
MDL Number: | MFCD11505878 |
SMILES: | Brc1cccc2c1n(nc2)C(=O)OC(C)(C)C |
Complexity: | 303 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 2 |
XLogP3: | 3.5 |
The tert-Butyl 7-bromo-1H-indazole-1-carboxylate is a versatile compound commonly employed in chemical synthesis. This compound serves as a valuable building block in the creation of various pharmaceuticals, agrochemicals, and advanced materials. Its unique structure and reactivity make it particularly useful in the development of new organic compounds through strategic functional group transformations. In reactions involving cross-coupling, nucleophilic substitution, or palladium-catalyzed transformations, tert-Butyl 7-bromo-1H-indazole-1-carboxylate plays a crucial role in facilitating the synthesis of complex molecules with high efficiency and precision. Its compatibility with a wide range of synthetic methods makes it an essential reagent for the synthesis of diverse molecular structures with potential applications in medicinal chemistry and materials science.