AE16732
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $8.00 | $6.00 | - + | |
250mg | 98% | in stock | $18.00 | $13.00 | - + | |
1g | 98% | in stock | $52.00 | $36.00 | - + | |
5g | 98% | in stock | $241.00 | $169.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE16732 |
Chemical Name: | 3-(5-(Trifluoromethyl)-1,2,4-oxadiazol-3-yl)benzoic acid |
CAS Number: | 1092400-82-2 |
Molecular Formula: | C10H5F3N2O3 |
Molecular Weight: | 258.1535 |
MDL Number: | MFCD09907879 |
SMILES: | OC(=O)c1cccc(c1)c1noc(n1)C(F)(F)F |
Complexity: | 324 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 8 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 2.2 |
Journal of medicinal chemistry 20081225