AI07663
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $382.00 | $267.00 | - + | |
1g | 95% | in stock | $1,142.00 | $799.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI07663 |
Chemical Name: | Methyl 2-(4-bromophenyl)-1-(tert-butoxycarbonylamino)cyclopropanecarboxylate |
CAS Number: | 1092460-42-8 |
Molecular Formula: | C16H20BrNO4 |
Molecular Weight: | 370.2383 |
MDL Number: | MFCD11501886 |
SMILES: | COC(=O)C1(CC1c1ccc(cc1)Br)NC(=O)OC(C)(C)C |
Methyl 2-(4-bromophenyl)-1-[[(1,1-dimethylethoxy)carbonyl]amino]cyclopropanecarboxylate serves as a versatile building block in chemical synthesis, particularly in the development of novel pharmaceutical compounds. This compound is utilized for its strategic placement of functional groups, allowing for precise manipulation and modification during synthetic pathways. The cyclopropane ring confers rigidity and unique stereochemical properties, making it a valuable scaffold for designing bioactive molecules. In addition, the presence of the bromophenyl and carbamate moieties offers diverse opportunities for further derivatization to generate structurally diverse compounds with potential biological activities.