logo
Home  > GW 833972A hydrochloride - Bio-X

AX46826

1092502-33-4 | GW 833972A hydrochloride - Bio-X

Packsize Purity Availability Price Discounted Price    Quantity
5mg 99% 1 week $832.00 $582.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AX46826
Chemical Name: GW 833972A hydrochloride - Bio-X
CAS Number: 1092502-33-4
Molecular Formula: C18H14Cl2F3N5O
Molecular Weight: 444.2379
MDL Number: MFCD18452844
SMILES: Clc1cccc(c1)Nc1ncc(c(n1)C(F)(F)F)C(=O)NCc1ccncc1.Cl

 

Computed Properties
Complexity: 518  
Covalently-Bonded Unit Count: 2  
Heavy Atom Count: 29  
Hydrogen Bond Acceptor Count: 8  
Hydrogen Bond Donor Count: 3  
Rotatable Bond Count: 5  

 

 

Upstream Synthesis Route
  • 2-[(3-Chlorophenyl)amino]-N-(4-pyridinylmethyl)-4-(trifluoromethyl)-5-pyrimidinecarboxamide hydrochloride is a versatile compound commonly used in chemical synthesis due to its unique properties and reactivity. This compound serves as a valuable building block in the creation of various pharmaceuticals, agrochemicals, and specialty chemicals.In chemical synthesis, 2-[(3-Chlorophenyl)amino]-N-(4-pyridinylmethyl)-4-(trifluoromethyl)-5-pyrimidinecarboxamide hydrochloride can act as a key intermediate in the preparation of novel drug candidates or active pharmaceutical ingredients. Its trifluoromethyl group enhances the compound's lipophilicity and metabolic stability, making it a promising candidate for drug development. Additionally, the presence of the pyridinylmethyl and pyrimidinecarboxamide moieties provides opportunities for further functionalization and structural modifications to tailor the compound's properties for specific applications.Overall, 2-[(3-Chlorophenyl)amino]-N-(4-pyridinylmethyl)-4-(trifluoromethyl)-5-pyrimidinecarboxamide hydrochloride plays a crucial role in the synthesis of diverse chemical compounds, highlighting its importance in the field of organic chemistry and drug discovery.
FEATURED PRODUCTS