1092522-02-5 | (4-Amino-phenyl)-methyl-carbamic acid tert-butyl ester

Packsize	Purity	Availability	Price	Discounted Price
250mg	95%	in stock	$65.00	$45.00
1g	95%	in stock	$151.00	$106.00
5g	95%	in stock	$445.00	$311.00
25g	95%	in stock	$2,173.00	$1,521.00

Description

• Catalog Number: AE22671
• Chemical Name: (4-Amino-phenyl)-methyl-carbamic acid tert-butyl ester
• CAS Number: 1092522-02-5
• Molecular Formula: C12H18N2O2
• Molecular Weight: 222.2835
• MDL Number: MFCD10693199
• SMILES: CN(c1ccc(cc1)N)C(=O)OC(C)(C)C

Upstream Synthesis Route

The tert-Butyl (4-aminophenyl)(methyl)carbamate is a versatile compound commonly used in chemical synthesis as a key building block for the preparation of various pharmaceuticals, agrochemicals, and specialty chemicals. This compound plays a crucial role in organic synthesis due to its reactivity and functional group diversity, making it a valuable tool for the creation of complex molecules.In chemical synthesis, tert-Butyl (4-aminophenyl)(methyl)carbamate serves as a valuable intermediate for the synthesis of carbamate derivatives, which have shown significant biological activities in medicinal chemistry. This compound can undergo various transformations, such as deprotection of the carbamate group, substitution reactions, and coupling reactions, to generate structurally diverse compounds with potential applications in drug discovery and development.Furthermore, tert-Butyl (4-aminophenyl)(methyl)carbamate can be used in the synthesis of advanced materials, such as polymers and dendrimers, where its reactive functional groups can be harnessed for controlled polymerization and structure design. This compound's unique chemical properties make it a valuable building block for the construction of functional materials with tailored properties and structures.Overall, tert-Butyl (4-aminophenyl)(methyl)carbamate plays a crucial role in chemical synthesis by enabling the efficient and selective construction of complex molecules with diverse applications in pharmaceuticals, agrochemicals, and materials science.