AE10970
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5mg | 98% | in stock | $336.00 | $235.00 | - + | |
10mg | 98% | in stock | $530.00 | $371.00 | - + | |
25mg | 98% | in stock | $1,057.00 | $740.00 | - + | |
50mg | 98% | in stock | $1,762.00 | $1,233.00 | - + | |
100mg | 98% | in stock | $3,007.00 | $2,105.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE10970 |
Chemical Name: | (3S,4S)-Tofacitinib |
CAS Number: | 1092578-47-6 |
Molecular Formula: | C16H20N6O |
Molecular Weight: | 312.3696 |
MDL Number: | MFCD11035920 |
SMILES: | N#CCC(=O)N1CC[C@@H]([C@@H](C1)N(c1ncnc2c1cc[nH]2)C)C |
(3S,4S)-4-Methyl-3-(methyl-7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)-β-oxo-1-piperidinepropanenitrile is a versatile compound commonly used in chemical synthesis as a key intermediate for the construction of various bioactive molecules. Due to its unique structure and functional groups, this compound plays a crucial role in the development of pharmaceuticals, agrochemicals, and materials science.In chemical synthesis, (3S,4S)-4-Methyl-3-(methyl-7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)-β-oxo-1-piperidinepropanenitrile serves as a building block for the creation of complex molecular structures. Its piperidine backbone provides a rigid and chiral scaffold that can influence the stereochemical outcome of subsequent reactions, making it valuable in the synthesis of enantiopure compounds.Moreover, the presence of the pyrrolopyrimidine moiety in this compound imparts specific chemical reactivity, allowing for selective functionalization and diversification of the molecule through various synthetic strategies. By strategically modifying the different parts of the molecule, chemists can tailor its properties for specific applications, such as drug discovery or materials design.Overall, (3S,4S)-4-Methyl-3-(methyl-7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)-β-oxo-1-piperidinepropanenitrile is a valuable tool in chemical synthesis, enabling the creation of structurally diverse and functionally rich compounds with potential applications across a range of scientific disciplines.