109485-62-3 | Undecane, 2,2,4,4,6,6,8,8,10-nonamethyl-

Availability
Typically In Stock

Description

• Catalog Number: AY29204
• Chemical Name: Undecane, 2,2,4,4,6,6,8,8,10-nonamethyl-
• CAS Number: 109485-62-3
• Molecular Formula: C20H42
• Molecular Weight: 282.5475
• SMILES: CC(CC(CC(CC(CC(C)(C)C)(C)C)(C)C)(C)C)C

Upstream Synthesis Route

Undecane, 2,2,4,4,6,6,8,8,10-nonamethyl-, commonly known as PMNT, is a versatile compound extensively used in chemical synthesis. This unique chemical plays a crucial role in the creation of various products and materials in industries such as pharmaceuticals, fragrances, and materials science. Its long hydrocarbon chain and methyl branches provide PMNT with exceptional properties that make it highly valuable in carrying out specific chemical reactions and forming complex molecular structures. In chemical synthesis processes, Undecane, 2,2,4,4,6,6,8,8,10-nonamethyl- acts as a key building block, enabling the development of innovative compounds with diverse applications. Its compatibility with different reagents and reaction conditions makes it an essential ingredient in the synthesis of specialized chemicals and materials with tailored properties and functionalities.