AE10391
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $12.00 | $9.00 | - + | |
5mg | 98% | in stock | $28.00 | $19.00 | - + | |
10mg | 98% | in stock | $42.00 | $30.00 | - + | |
25mg | 98% | in stock | $69.00 | $49.00 | - + | |
50mg | 98% | in stock | $116.00 | $82.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE10391 |
Chemical Name: | Jnj-31020028 |
CAS Number: | 1094873-14-9 |
Molecular Formula: | C34H36FN5O2 |
Molecular Weight: | 565.6803 |
MDL Number: | MFCD18782744 |
SMILES: | CCN(C(=O)C(c1ccccc1)N1CCN(CC1)c1ccc(cc1F)NC(=O)c1ccccc1c1cccnc1)CC |
Complexity: | 857 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 42 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 9 |
Undefined Atom Stereocenter Count: | 1 |
XLogP3: | 5.3 |
Toxicology 20180601
American journal of physiology. Gastrointestinal and liver physiology 20120401
Behavioural brain research 20110923
Bioorganic & medicinal chemistry letters 20110915
Alcohol (Fayetteville, N.Y.) 20110901
Psychopharmacology 20100201
Drug metabolism and disposition: the biological fate of chemicals 19750101