AB42891
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 97% | in stock | $8.00 | $5.00 | - + | |
250mg | 97% | in stock | $12.00 | $8.00 | - + | |
1g | 97% | in stock | $39.00 | $27.00 | - + | |
5g | 97% | in stock | $164.00 | $115.00 | - + | |
10g | 97% | in stock | $251.00 | $176.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB42891 |
Chemical Name: | (R)-2,5-Dihydro-3,6-dimethoxy-2-isopropylpyrazine |
CAS Number: | 109838-85-9 |
Molecular Formula: | C9H16N2O2 |
Molecular Weight: | 184.2355 |
MDL Number: | MFCD00040565 |
SMILES: | COC1=N[C@@H](C(=NC1)OC)C(C)C |
Complexity: | 234 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 3 |
XLogP3: | 1.4 |
Bioorganic & medicinal chemistry letters 20040223
The Journal of organic chemistry 20020419