AI08058
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 97% | in stock | $105.00 | $74.00 | - + | |
250mg | 97% | in stock | $180.00 | $126.00 | - + | |
1g | 97% | in stock | $457.00 | $320.00 | - + | |
5g | 97% | in stock | $1,754.00 | $1,228.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI08058 |
Chemical Name: | 3-(Methoxycarbonyl)indole-5-boronic acid pinacol ester |
CAS Number: | 1100052-63-8 |
Molecular Formula: | C16H20BNO4 |
Molecular Weight: | 301.1453 |
MDL Number: | MFCD20486631 |
SMILES: | COC(=O)c1c[nH]c2c1cc(cc2)B1OC(C(O1)(C)C)(C)C |
Complexity: | 437 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 22 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
3-(Methoxycarbonyl)indole-5-boronic acid pinacol ester is a versatile compound widely used in chemical synthesis for various applications. In organic chemistry, it serves as a key building block for the preparation of complex molecules due to its unique structural properties and reactivity. One of the primary applications of this compound lies in its utility as a valuable reagent in Suzuki-Miyaura cross-coupling reactions. This powerful synthetic method allows for the efficient formation of carbon-carbon bonds under mild conditions, enabling the rapid construction of diverse molecular architectures. Additionally, 3-(Methoxycarbonyl)indole-5-boronic acid pinacol ester plays a crucial role in the synthesis of pharmaceuticals, agrochemicals, and materials science, where precise control over molecular structure is essential for desired properties and functions. Its ability to participate in selective C-H functionalization and other catalytic transformations further expands its synthetic utility, making it a valuable tool for the modern chemist seeking innovative ways to design and construct complex molecules.