110127-07-6 | 1,3-dibromo-2-methyl-5-nitrobenzene

Packsize	Purity	Availability	Price	Discounted Price
100mg	95%	in stock	$226.00	$159.00
1g	95%	in stock	$687.00	$481.00

Description

• Catalog Number: AB60588
• Chemical Name: 1,3-dibromo-2-methyl-5-nitrobenzene
• CAS Number: 110127-07-6
• Molecular Formula: C7H5Br2NO2
• Molecular Weight: 294.9281
• MDL Number: MFCD00151807
• SMILES: [O-][N+](=O)c1ccc(c(c1Br)C)Br

Upstream Synthesis Route

1,3-Dibromo-2-methyl-4-nitrobenzene is a versatile compound commonly used in chemical synthesis as a building block for more complex molecules. This compound serves as a valuable intermediate in the preparation of various organic compounds due to its unique structural properties.In chemical synthesis, 1,3-Dibromo-2-methyl-4-nitrobenzene can participate in numerous reactions such as nucleophilic substitutions, palladium-catalyzed cross-coupling reactions, and cycloadditions. Its bromine substituents can undergo displacement reactions to introduce different functional groups, expanding its chemical reactivity and potential applications.Furthermore, the nitro group in 1,3-Dibromo-2-methyl-4-nitrobenzene can serve as a versatile handle for further chemical modifications, allowing for the introduction of a wide range of functional groups. This enables chemists to tailor the compound's properties to suit specific synthesis requirements and target molecules.Overall, 1,3-Dibromo-2-methyl-4-nitrobenzene plays a crucial role in the synthesis of organic compounds by offering a starting point for the construction of more complex structures through various chemical transformations. Its versatility and reactivity make it a valuable asset in the toolkit of synthetic chemists seeking to design and create novel molecules for various applications.