logo
Home  > 9-(2,3-Dideoxy-2-fluoro-alpha-D-threopentofuranosyl)-adenine

AE16444

110143-10-7 | 9-(2,3-Dideoxy-2-fluoro-alpha-D-threopentofuranosyl)-adenine

Availability
Typically In Stock

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AE16444
Chemical Name: 9-(2,3-Dideoxy-2-fluoro-alpha-D-threopentofuranosyl)-adenine
CAS Number: 110143-10-7
Molecular Formula: C10H12FN5O2
Molecular Weight: 253.233
MDL Number: MFCD00871105
SMILES: OC[C@@H]1C[C@@H]([C@@H](O1)n1cnc2c1ncnc2N)F

 

Upstream Synthesis Route
  • Lodenosine, a potent nucleoside analog, plays a crucial role in chemical synthesis as a key building block for various pharmaceutical compounds and biologically active molecules. Its unique chemical structure and functional groups make it a versatile component in the creation of antiviral, anticancer, and antifungal agents.Lodenosine is commonly used in the synthesis of nucleoside analogs and nucleotide derivatives, which are essential for the development of novel drugs targeting viral infections such as HIV and hepatitis. By incorporating Lodenosine into the molecular structure of these compounds, researchers can enhance their bioavailability, efficacy, and selectivity against specific pathogens.Moreover, Lodenosine serves as a valuable intermediate in the preparation of purine and pyrimidine nucleosides, which are critical components of nucleic acids like DNA and RNA. This makes it an indispensable tool in fundamental research and drug discovery efforts aimed at understanding genetic diseases and developing gene-targeted therapies.In addition to its role in medicinal chemistry, Lodenosine also finds applications in carbohydrate chemistry and organic synthesis. Its compatibility with various reaction conditions and ability to participate in diverse chemical transformations make it an attractive substrate for building complex molecular architectures and functionalized materials.Overall, Lodenosine's versatility and synthetic utility make it a prized asset in the arsenal of chemists and researchers working towards advancing the frontiers of pharmaceuticals, biotechnology, and materials science.
FEATURED PRODUCTS