AE08530
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
50mg | in stock | $142.00 | $99.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE08530 |
Chemical Name: | OUABAIN OCTAHYDRATE |
CAS Number: | 11018-89-6 |
Molecular Formula: | C29H46O13 |
Molecular Weight: | 602.6677 |
MDL Number: | MFCD00149240 |
SMILES: | OC[C@@]12[C@H](O)C[C@@H](C[C@@]2(O)CC[C@@H]2[C@@H]1[C@H](O)C[C@]1([C@]2(O)CC[C@@H]1C1=CC(=O)OC1)C)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O.O |
Card-20(22)-enolide, 3-[(6-deoxy-α-L-mannopyranosyl)oxy]-1,5,11,14,19-pentahydroxy-, octahydrate, (1β,3β,5β,11α) is a valuable compound in chemical synthesis. Its unique structure and properties make it highly useful in organic chemistry applications. This compound can serve as a key building block in the synthesis of various complex natural products and pharmaceutical compounds. Its multiple hydroxyl groups offer versatile reactivity, enabling the introduction of additional functional groups or the formation of intricate molecular architectures. In addition, the presence of the mannopyranosyl moiety provides a chiral center that can be exploited in asymmetric synthesis strategies. Overall, Card-20(22)-enolide, 3-[(6-deoxy-α-L-mannopyranosyl)oxy]-1,5,11,14,19-pentahydroxy-, octahydrate, (1β,3β,5β,11α) is a valuable tool for chemists seeking to access diverse and structurally complex compounds through synthetic routes.