logo
Home  > JZL 184

AE10344

1101854-58-3 | JZL 184

Packsize Purity Availability Price Discounted Price    Quantity
10mg 98% in stock $32.00 $22.00 -   +
25mg 98% in stock $53.00 $37.00 -   +
100mg 98% in stock $139.00 $97.00 -   +
250mg 98% in stock $235.00 $164.00 -   +
1g 98% in stock $626.00 $438.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AE10344
Chemical Name: JZL 184
CAS Number: 1101854-58-3
Molecular Formula: C27H24N2O9
Molecular Weight: 520.4875
MDL Number: MFCD11976911
SMILES: O=C(N1CCC(CC1)C(c1ccc2c(c1)OCO2)(c1ccc2c(c1)OCO2)O)Oc1ccc(cc1)[N+](=O)[O-]

 

Upstream Synthesis Route 
  • The 4-Nitrophenyl 4-(bis(benzo[d][1,3]dioxol-5-yl)(hydroxy)methyl)piperidine-1-carboxylate is a versatile compound widely utilized in chemical synthesis as a key intermediate. It plays a crucial role in various synthetic pathways due to its unique structure and reactivity. This compound specifically serves as a valuable building block in the creation of complex organic molecules, facilitating the construction of diverse molecular architectures with specific functionalities. Its presence enables the efficient formation of intricate chemical structures, making it an essential component in the synthesis of pharmaceuticals, agrochemicals, and advanced materials.
FEATURED PRODUCTS